![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | 1.jpg | 2021-04-29 13:25 | 117K | |
| 3.jpg | 2021-04-29 13:26 | 99K | |
| 7.jpg | 2021-04-29 13:27 | 101K | |
| 13.jpg | 2021-04-29 13:28 | 81K | |
| 17.jpg | 2021-04-29 13:28 | 74K | |
| 18.jpg | 2021-04-29 13:28 | 78K | |
| 19.jpg | 2021-04-29 13:28 | 78K | |
| 28.jpg | 2021-04-29 13:29 | 90K | |
| 29.jpg | 2021-04-29 13:29 | 118K | |
| 30.jpg | 2021-04-29 13:29 | 97K | |
| All-Day_Dinning_Restaurant_Grand_Hotel_Sveti_Vlas.jpg | 2025-04-14 13:57 | 150K | |
| Finish_Sauna_SPA_Grand_Hotel_Sveti_Vlas.jpg | 2025-04-14 14:34 | 79K | |
| Fitness_hall_Grand_Hotel_Sveti_Vlas.jpg | 2025-04-14 14:28 | 153K | |
| Grand Hotel Sveti Vlas -indoor thermal pool in the SPA.jpg | 2025-04-14 14:30 | 118K | |
| Grand Hotel Sveti Vlas Double Deluxe Room with balcony and side sea view.jpg | 2025-04-14 14:24 | 83K | |
| Grand Hotel Sveti Vlas front view.jpg | 2025-04-14 13:56 | 132K | |
| Grand Hotel Sveti Vlas jacuzzi in the adults only SPA zone.jpg | 2025-04-14 14:34 | 90K | |
| Grand Hotel Sveti Vlas kids club gaming zone.jpg | 2025-04-14 14:35 | 122K | |
| Grand Hotel Sveti Vlas kids club with all-day animator.jpg | 2025-04-14 14:35 | 112K | |
| Grand Hotel Sveti Vlas looby and reception area.jpg | 2025-04-14 14:12 | 125K | |
| Grand Hotel Sveti Vlas lounge.jpg | 2025-04-14 14:01 | 110K | |
| Grand Hotel Sveti Vlas lounge bar area.jpg | 2025-04-14 14:00 | 126K | |
| Grand Hotel Sveti Vlas outdoor SPA facilities.jpg | 2025-04-14 14:26 | 60K | |
| Grand Hotel Sveti Vlas outside SPA zone.jpg | 2025-04-14 14:26 | 67K | |
| MQ==.jpg | 2021-06-25 15:26 | 117K | |
| Mg==.jpg | 2021-06-25 15:26 | 110K | |
| Mw==.jpg | 2021-06-25 15:26 | 99K | |
| NA==.jpg | 2021-06-25 15:26 | 106K | |
| NQ==.jpg | 2021-06-25 15:26 | 97K | |
| Ng==.jpg | 2021-06-25 15:26 | 103K | |
| Outdoor_SPA_Area_with_Jacuzzi_and_Thermal_pool_Grand_Hotel_Sveti_Vlas.jpg | 2025-04-14 14:27 | 120K | |
| Rain_shower_in_thermal_indoor_pool_SPA_Grand_hotel_Sveti_Vlas.jpg | 2025-04-14 14:30 | 84K | |
| Relax_area_Adults_only_SPA_Center_Grand_Hotel_Sveti_Vlas.jpg | 2025-04-14 14:34 | 69K | |
| Restaurant_Grand_Hotel_Sveti_Vlas.jpg | 2025-04-14 13:58 | 145K | |
| Sauna_in_Adults_Only_zone_SPA-Center-Grand_HotelSveti_vlas.jpg | 2025-04-14 14:34 | 126K | |
| Steam-bath_SPA_Grand_Hotel-Sveti_Vlas.jpg | 2025-04-14 14:34 | 133K | |
|
|---|
